| CAS No.: | 105-59-9 |
|---|---|
| Other Names: | N-Methylediethanolamine |
| MF: | |
| EINECS No.: | 203-312-7 |
| Place of Origin: | China (Mainland) |
| Purity: | 99% |
| Classification: | High Purity Reagents |
| Brand Name: | |
| Model Number: |
Quick Details
Specifications
N-Methyldiethanolamine
Product parameters: alias/chemical name:;Methyl diethanolamine;
CAS NO: 105-59-9
Content (%): 99
EINECS: 203-312-7
Molecular formula: C5H13NO2
molecular weight: 119.16372
InChI: InChI=1/C5H13NO2/c1-6(2-4-7)3-5-8/h7-8H,2-5H2,1H3/p+1
melting point: -21℃
boiling poin : 247°C at 760 mmHg
flash point : 126.7°C
Water soluble: miscible
Physical and chemical properties:
Appearance colorless or light yellow viscous liquid
boiling poin 246~248℃
flash point 260℃
freezing point -21℃
latent heat 519.16KJ/Kg
boiling poin 247℃
Solubility in water soluble in water and alcohol, slightly soluble in ether