Chromic Acid Fog Inhibitor/FC-248/Cas No.:56773-42-3

Tetraethyl ammonium, Perfluorooctanesulfonate (FC-248)

CAS:56773-42-3

Trade name:FC-248

Chemical Name:Tetraethylammonium perfluorooctanesulfonate

Molecular Formula:CF3(CF2)7SO3-(C2H5)4N+

Molecular Formula:C16H20F17NSO3

Molecular Weight:629

Assay:98%       

Appearance:White powder 

Surface Tension:22mN/m(0.1% aqueous solution)

Application:

1. Used as chrome-fume suppressor for both Decorative and functional chromium plating. (level of addition: 25mg~50mg/ Liter )
2. Used as wetting agent, leveling agent and antistatic agent for photographic Paper and film
3. Used as wetting agent for glass etching and opacification baths
4. Used as wetting agent for acid baths for metal surface treatment  e.g. Anodizing baths, chromatizing baths.
5. Used as demould agent for plastic